About N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane
N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane (PubChem CID 176558034) has the molecular formula C18H36F2N2
and a molecular weight of 318.50 g/mol. Its IUPAC name is N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane.
Molecular Properties
| Compound Name | N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane |
| PubChem CID | 176558034 |
| Molecular Formula | C18H36F2N2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane |
| SMILES | CC.CCN(C1CCC2(CC1)CN(CC(C)C)C2)C(C)(F)F |
| InChI | InChI=1S/C16H30F2N2.C2H6/c1-5-20(15(4,17)18)14-6-8-16(9-7-14)11-19(12-16)10-13(2)3;1-2/h13-14H,5-12H2,1-4H3;1-2H3 |
| InChIKey | PZIAAOOQWVPMNR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane?
The IUPAC name of N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane (CID 176558034) is N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane.
What is the SMILES notation for N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane?
The canonical SMILES for N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane is CC.CCN(C1CCC2(CC1)CN(CC(C)C)C2)C(C)(F)F.
What is the InChIKey of N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane?
The InChIKey is PZIAAOOQWVPMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30F2N2.C2H6/c1-5-20(15(4,17)18)14-6-8-16(9-7-14)11-19(12-16)10-13(2)3;1-2/h13-14H,5-12H2,1-4H3;1-2H3.
What are the key properties of N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane?
N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane has a molecular weight of 318.50 g/mol, XLogP of 4.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-difluoroethyl)-N-ethyl-2-(2-methylpropyl)-2-azaspiro[3.5]nonan-7-amine;ethane is sourced from PubChem (CID 176558034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).