C16H32N2 — CID 129193421
2,8-bis(2-methylpropyl)-2,8-diazaspiro[4.5]decane (PubChem CID 129193421) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2,8-bis(2-methylpropyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 2,8-bis(2-methylpropyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 129193421 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2,8-bis(2-methylpropyl)-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)CN1CCC2(CC1)CCN(CC(C)C)C2 |
| InChI | InChI=1S/C16H32N2/c1-14(2)11-17-8-5-16(6-9-17)7-10-18(13-16)12-15(3)4/h14-15H,5-13H2,1-4H3 |
| InChIKey | OIFQWPFBZKCBQZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |