C19H45N — CID 154670691
4,4-diethyl-1-(2-methylpropyl)piperidine;ethane (PubChem CID 154670691) has the molecular formula C19H45N and a molecular weight of 287.58 g/mol. Its IUPAC name is 4,4-diethyl-1-(2-methylpropyl)piperidine;ethane.
| Compound Name | 4,4-diethyl-1-(2-methylpropyl)piperidine;ethane |
|---|---|
| PubChem CID | 154670691 |
| Molecular Formula | C19H45N |
| Molecular Weight | 287.58 g/mol |
| Exact Mass | 287.36 |
| IUPAC Name | 4,4-diethyl-1-(2-methylpropyl)piperidine;ethane |
| SMILES | CC.CC.CC.CCC1(CC)CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C13H27N.3C2H6/c1-5-13(6-2)7-9-14(10-8-13)11-12(3)4;3*1-2/h12H,5-11H2,1-4H3;3*1-2H3 |
| InChIKey | RZYIHZOVDHNIMU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |