C8H12N6 — CID 175710556
(2S,3aS,5S,6aS)-2,5-diazido-1-deuterio-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 175710556) has the molecular formula C8H12N6 and a molecular weight of 193.23 g/mol. Its IUPAC name is (2S,3aS,5S,6aS)-2,5-diazido-1-deuterio-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | (2S,3aS,5S,6aS)-2,5-diazido-1-deuterio-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 175710556 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (2S,3aS,5S,6aS)-2,5-diazido-1-deuterio-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | [2H]C1[C@@H](N=[N+]=[N-])C[C@@H]2C[C@H](N=[N+]=[N-])C[C@@H]12 |
| InChI | InChI=1S/C8H12N6/c9-13-11-7-1-5-2-8(12-14-10)4-6(5)3-7/h5-8H,1-4H2/t5-,6-,7-,8-/i1D/t1?,5-,6-,7-,8-/m1/s1 |
| InChIKey | QLQCKJSLGVQSRJ-BJWFWFOLSA-N |
| XLogP | 3.16 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|