C4H7N3 — CID 10749143
trans-(1S,2S)-1-(15N)azido-2-methylcyclopropane (PubChem CID 10749143) has the molecular formula C4H7N3 and a molecular weight of 98.11 g/mol. Its IUPAC name is trans-(1S,2S)-1-(15N)azido-2-methylcyclopropane.
| Compound Name | trans-(1S,2S)-1-(15N)azido-2-methylcyclopropane |
|---|---|
| PubChem CID | 10749143 |
| Molecular Formula | C4H7N3 |
| Molecular Weight | 98.11 g/mol |
| Exact Mass | 98.06 |
| IUPAC Name | trans-(1S,2S)-1-(15N)azido-2-methylcyclopropane |
| SMILES | C[C@H]1C[C@@H]1[15N]=[N+]=[N-] |
| InChI | InChI=1S/C4H7N3/c1-3-2-4(3)6-7-5/h3-4H,2H2,1H3/t3-,4-/m0/s1/i6+1 |
| InChIKey | PKSJFBWRQJMPBX-KAGRDHMKSA-N |
| XLogP | 1.71 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|