C10H18N4O — CID 118565917
(1S,3R,4S)-4-azido-N,N,3-trimethylcyclohexane-1-carboxamide (PubChem CID 118565917) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is (1S,3R,4S)-4-azido-N,N,3-trimethylcyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4S)-4-azido-N,N,3-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118565917 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (1S,3R,4S)-4-azido-N,N,3-trimethylcyclohexane-1-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C(=O)N(C)C)CC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C10H18N4O/c1-7-6-8(10(15)14(2)3)4-5-9(7)12-13-11/h7-9H,4-6H2,1-3H3/t7-,8+,9+/m1/s1 |
| InChIKey | VLUVDZUKFDVDEX-VGMNWLOBSA-N |
| XLogP | 2.19 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|