About 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide
3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 83618379) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide.
Analyze 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide?
The IUPAC name of 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide (CID 83618379) is 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide.
What is the SMILES notation for 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide?
The canonical SMILES for 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide is CN(C)C(=O)C1CCC(CN)C1.
What is the InChIKey of 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide?
The InChIKey is NQBZTTSGBSRCHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-11(2)9(12)8-4-3-7(5-8)6-10/h7-8H,3-6,10H2,1-2H3.
What are the key properties of 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide?
3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide has a molecular weight of 170.26 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N,N-dimethylcyclopentane-1-carboxamide is sourced from PubChem (CID 83618379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).