C5H8N6O — CID 173485365
trans-(3R,4R)-3,4-diazidocyclopentan-1-ol (PubChem CID 173485365) has the molecular formula C5H8N6O and a molecular weight of 168.16 g/mol. Its IUPAC name is trans-(3R,4R)-3,4-diazidocyclopentan-1-ol.
| Compound Name | trans-(3R,4R)-3,4-diazidocyclopentan-1-ol |
|---|---|
| PubChem CID | 173485365 |
| Molecular Formula | C5H8N6O |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | trans-(3R,4R)-3,4-diazidocyclopentan-1-ol |
| SMILES | [N-]=[N+]=N[C@@H]1CC(O)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C5H8N6O/c6-10-8-4-1-3(12)2-5(4)9-11-7/h3-5,12H,1-2H2/t4-,5-/m1/s1 |
| InChIKey | JVIULFLLDILRFU-RFZPGFLSSA-N |
| XLogP | 1.50 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|