About (3-azidocyclobutyl) formate
(3-azidocyclobutyl) formate (PubChem CID 57097738) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is (3-azidocyclobutyl) formate.
Molecular Properties
| Compound Name | (3-azidocyclobutyl) formate |
| PubChem CID | 57097738 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | (3-azidocyclobutyl) formate |
| SMILES | [N-]=[N+]=NC1CC(OC=O)C1 |
| InChI | InChI=1S/C5H7N3O2/c6-8-7-4-1-5(2-4)10-3-9/h3-5H,1-2H2 |
| InChIKey | AFRZPVCPUZJXPI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3-azidocyclobutyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-azidocyclobutyl) formate?
The IUPAC name of (3-azidocyclobutyl) formate (CID 57097738) is (3-azidocyclobutyl) formate.
What is the SMILES notation for (3-azidocyclobutyl) formate?
The canonical SMILES for (3-azidocyclobutyl) formate is [N-]=[N+]=NC1CC(OC=O)C1.
What is the InChIKey of (3-azidocyclobutyl) formate?
The InChIKey is AFRZPVCPUZJXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c6-8-7-4-1-5(2-4)10-3-9/h3-5H,1-2H2.
What are the key properties of (3-azidocyclobutyl) formate?
(3-azidocyclobutyl) formate has a molecular weight of 141.13 g/mol, XLogP of 1.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-azidocyclobutyl) formate is sourced from PubChem (CID 57097738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).