C8H11N3O7 — CID 90908353
[(3S,5S,6R)-5-azido-4-formyloxy-3,6-dihydroxyoxan-2-yl]methyl formate (PubChem CID 90908353) has the molecular formula C8H11N3O7 and a molecular weight of 261.19 g/mol. Its IUPAC name is [(3S,5S,6R)-5-azido-4-formyloxy-3,6-dihydroxyoxan-2-yl]methyl formate.
| Compound Name | [(3S,5S,6R)-5-azido-4-formyloxy-3,6-dihydroxyoxan-2-yl]methyl formate |
|---|---|
| PubChem CID | 90908353 |
| Molecular Formula | C8H11N3O7 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [(3S,5S,6R)-5-azido-4-formyloxy-3,6-dihydroxyoxan-2-yl]methyl formate |
| SMILES | [N-]=[N+]=N[C@H]1C(OC=O)[C@H](O)C(COC=O)O[C@H]1O |
| InChI | InChI=1S/C8H11N3O7/c9-11-10-5-7(17-3-13)6(14)4(1-16-2-12)18-8(5)15/h2-8,14-15H,1H2/t4?,5-,6+,7?,8+/m0/s1 |
| InChIKey | RFCGHGGMGIBYSH-ZMZKTPDWSA-N |
| XLogP | -1.54 |
| TPSA | 151.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|