C2H2N6O — CID 135383367
2,3-diazidooxirane (PubChem CID 135383367) has the molecular formula C2H2N6O and a molecular weight of 126.08 g/mol. Its IUPAC name is 2,3-diazidooxirane.
| Compound Name | 2,3-diazidooxirane |
|---|---|
| PubChem CID | 135383367 |
| Molecular Formula | C2H2N6O |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 2,3-diazidooxirane |
| SMILES | [N-]=[N+]=NC1OC1N=[N+]=[N-] |
| InChI | InChI=1S/C2H2N6O/c3-7-5-1-2(9-1)6-8-4/h1-2H |
| InChIKey | PSYADMIJJSNTEP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 110.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|