About 2,3-diazidooxirane
2,3-diazidooxirane (PubChem CID 135383367) has the molecular formula C2H2N6O
and a molecular weight of 126.08 g/mol. Its IUPAC name is 2,3-diazidooxirane.
Molecular Properties
| Compound Name | 2,3-diazidooxirane |
| PubChem CID | 135383367 |
| Molecular Formula | C2H2N6O |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 2,3-diazidooxirane |
| SMILES | [N-]=[N+]=NC1OC1N=[N+]=[N-] |
| InChI | InChI=1S/C2H2N6O/c3-7-5-1-2(9-1)6-8-4/h1-2H |
| InChIKey | PSYADMIJJSNTEP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 110.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diazidooxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diazidooxirane?
The IUPAC name of 2,3-diazidooxirane (CID 135383367) is 2,3-diazidooxirane.
What is the SMILES notation for 2,3-diazidooxirane?
The canonical SMILES for 2,3-diazidooxirane is [N-]=[N+]=NC1OC1N=[N+]=[N-].
What is the InChIKey of 2,3-diazidooxirane?
The InChIKey is PSYADMIJJSNTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2N6O/c3-7-5-1-2(9-1)6-8-4/h1-2H.
What are the key properties of 2,3-diazidooxirane?
2,3-diazidooxirane has a molecular weight of 126.08 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diazidooxirane is sourced from PubChem (CID 135383367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).