C11H19FO4S — CID 10587828
[(1R,2S,3S,5R)-3-fluoro-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate (PubChem CID 10587828) has the molecular formula C11H19FO4S and a molecular weight of 266.33 g/mol. Its IUPAC name is [(1R,2S,3S,5R)-3-fluoro-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate.
| Compound Name | [(1R,2S,3S,5R)-3-fluoro-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 10587828 |
| Molecular Formula | C11H19FO4S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [(1R,2S,3S,5R)-3-fluoro-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl] methanesulfonate |
| SMILES | C=C(C)[C@H]1C[C@H](F)[C@@](C)(O)[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H19FO4S/c1-7(2)8-5-9(12)11(3,13)10(6-8)16-17(4,14)15/h8-10,13H,1,5-6H2,2-4H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | RCIGGPGISRXHIB-UKKRHICBSA-N |
| XLogP | 1.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|