C15H26O6S — CID 15657295
[(1'R,4'S,4'aR,8'aR)-4'-hydroxy-4',8'a-dimethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene]-1'-yl] methanesulfonate (PubChem CID 15657295) has the molecular formula C15H26O6S and a molecular weight of 334.43 g/mol. Its IUPAC name is [(1'R,4'S,4'aR,8'aR)-4'-hydroxy-4',8'a-dimethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene]-1'-yl] methanesulfonate.
| Compound Name | [(1'R,4'S,4'aR,8'aR)-4'-hydroxy-4',8'a-dimethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene]-1'-yl] methanesulfonate |
|---|---|
| PubChem CID | 15657295 |
| Molecular Formula | C15H26O6S |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [(1'R,4'S,4'aR,8'aR)-4'-hydroxy-4',8'a-dimethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene]-1'-yl] methanesulfonate |
| SMILES | C[C@@]12CCC3(C[C@H]1[C@@](C)(O)CC[C@H]2OS(C)(=O)=O)OCCO3 |
| InChI | InChI=1S/C15H26O6S/c1-13-6-7-15(19-8-9-20-15)10-11(13)14(2,16)5-4-12(13)21-22(3,17)18/h11-12,16H,4-10H2,1-3H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | FQLJTVDWZUTLDH-SYQHCUMBSA-N |
| XLogP | 1.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|