C18H31NO7S — CID 15630939
ethyl 4'-methylsulfonyloxy-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate (PubChem CID 15630939) has the molecular formula C18H31NO7S and a molecular weight of 405.51 g/mol. Its IUPAC name is ethyl 4'-methylsulfonyloxy-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate.
| Compound Name | ethyl 4'-methylsulfonyloxy-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 15630939 |
| Molecular Formula | C18H31NO7S |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl 4'-methylsulfonyloxy-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-3'-carboxylate |
| SMILES | CCCN1CC(C(=O)OCC)C(OS(C)(=O)=O)C2CC3(CCC21)OCCO3 |
| InChI | InChI=1S/C18H31NO7S/c1-4-8-19-12-14(17(20)23-5-2)16(26-27(3,21)22)13-11-18(7-6-15(13)19)24-9-10-25-18/h13-16H,4-12H2,1-3H3 |
| InChIKey | IOIMTDPXYZGDJV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|