C10H19NO7S2 — CID 87832607
ethyl 1-methylsulfonyl-4-methylsulfonyloxypiperidine-3-carboxylate (PubChem CID 87832607) has the molecular formula C10H19NO7S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 1-methylsulfonyl-4-methylsulfonyloxypiperidine-3-carboxylate.
| Compound Name | ethyl 1-methylsulfonyl-4-methylsulfonyloxypiperidine-3-carboxylate |
|---|---|
| PubChem CID | 87832607 |
| Molecular Formula | C10H19NO7S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | ethyl 1-methylsulfonyl-4-methylsulfonyloxypiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(S(C)(=O)=O)CCC1OS(C)(=O)=O |
| InChI | InChI=1S/C10H19NO7S2/c1-4-17-10(12)8-7-11(19(2,13)14)6-5-9(8)18-20(3,15)16/h8-9H,4-7H2,1-3H3 |
| InChIKey | OARUVSXMJRCWEA-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|