C10H17NO7S — CID 134872683
2-[(2R,3S)-1-ethoxycarbonyl-3-methylsulfonyloxypyrrolidin-2-yl]acetic acid (PubChem CID 134872683) has the molecular formula C10H17NO7S and a molecular weight of 295.31 g/mol. Its IUPAC name is 2-[(2R,3S)-1-ethoxycarbonyl-3-methylsulfonyloxypyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,3S)-1-ethoxycarbonyl-3-methylsulfonyloxypyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 134872683 |
| Molecular Formula | C10H17NO7S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[(2R,3S)-1-ethoxycarbonyl-3-methylsulfonyloxypyrrolidin-2-yl]acetic acid |
| SMILES | CCOC(=O)N1CC[C@H](OS(C)(=O)=O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C10H17NO7S/c1-3-17-10(14)11-5-4-8(18-19(2,15)16)7(11)6-9(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | VXFYFWGHAKNFMS-SFYZADRCSA-N |
| XLogP | 0.04 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|