C17H30O4 — CID 163082301
[(1R,4S,4aS,6S,8aR)-4,6-dihydroxy-4,8a-dimethyl-6-propan-2-yl-2,3,4a,5,7,8-hexahydro-1H-naphthalen-1-yl] acetate (PubChem CID 163082301) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is [(1R,4S,4aS,6S,8aR)-4,6-dihydroxy-4,8a-dimethyl-6-propan-2-yl-2,3,4a,5,7,8-hexahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1R,4S,4aS,6S,8aR)-4,6-dihydroxy-4,8a-dimethyl-6-propan-2-yl-2,3,4a,5,7,8-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 163082301 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | [(1R,4S,4aS,6S,8aR)-4,6-dihydroxy-4,8a-dimethyl-6-propan-2-yl-2,3,4a,5,7,8-hexahydro-1H-naphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@](C)(O)[C@H]2C[C@](O)(C(C)C)CC[C@@]12C |
| InChI | InChI=1S/C17H30O4/c1-11(2)17(20)9-8-15(4)13(10-17)16(5,19)7-6-14(15)21-12(3)18/h11,13-14,19-20H,6-10H2,1-5H3/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | VWSRUUYZMKAPCQ-BIVLZKPYSA-N |
| XLogP | 2.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |