C10H19NO3 — CID 123724975
1-methyl-2-nitroso-4-propan-2-ylcyclohexane-1,4-diol (PubChem CID 123724975) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-methyl-2-nitroso-4-propan-2-ylcyclohexane-1,4-diol.
| Compound Name | 1-methyl-2-nitroso-4-propan-2-ylcyclohexane-1,4-diol |
|---|---|
| PubChem CID | 123724975 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 1-methyl-2-nitroso-4-propan-2-ylcyclohexane-1,4-diol |
| SMILES | CC(C)C1(O)CCC(C)(O)C(N=O)C1 |
| InChI | InChI=1S/C10H19NO3/c1-7(2)10(13)5-4-9(3,12)8(6-10)11-14/h7-8,12-13H,4-6H2,1-3H3 |
| InChIKey | FQQGZOCUARHMRY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |