C10H20O2 — CID 130992035
(1S,3R,4S)-4-methyl-1-propan-2-ylcyclohexane-1,3-diol (PubChem CID 130992035) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (1S,3R,4S)-4-methyl-1-propan-2-ylcyclohexane-1,3-diol.
| Compound Name | (1S,3R,4S)-4-methyl-1-propan-2-ylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 130992035 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (1S,3R,4S)-4-methyl-1-propan-2-ylcyclohexane-1,3-diol |
| SMILES | CC(C)[C@]1(O)CC[C@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C10H20O2/c1-7(2)10(12)5-4-8(3)9(11)6-10/h7-9,11-12H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | PEFMIOBQXUUMNG-AEJSXWLSSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |