C15H24O2 — CID 163108945
(5R,8S,8aS)-5-hydroxy-3,8-dimethyl-5-propan-2-yl-1,4,6,7,8,8a-hexahydroazulen-2-one (PubChem CID 163108945) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (5R,8S,8aS)-5-hydroxy-3,8-dimethyl-5-propan-2-yl-1,4,6,7,8,8a-hexahydroazulen-2-one.
| Compound Name | (5R,8S,8aS)-5-hydroxy-3,8-dimethyl-5-propan-2-yl-1,4,6,7,8,8a-hexahydroazulen-2-one |
|---|---|
| PubChem CID | 163108945 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (5R,8S,8aS)-5-hydroxy-3,8-dimethyl-5-propan-2-yl-1,4,6,7,8,8a-hexahydroazulen-2-one |
| SMILES | CC1=C2C[C@@](O)(C(C)C)CC[C@H](C)[C@@H]2CC1=O |
| InChI | InChI=1S/C15H24O2/c1-9(2)15(17)6-5-10(3)12-7-14(16)11(4)13(12)8-15/h9-10,12,17H,5-8H2,1-4H3/t10-,12-,15+/m0/s1 |
| InChIKey | GHLQAKFVITUUSL-ITDIGPHOSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |