C22H26O3 — CID 45256473
(4-methylphenyl) 2-[(5S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 45256473) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (4-methylphenyl) 2-[(5S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | (4-methylphenyl) 2-[(5S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 45256473 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (4-methylphenyl) 2-[(5S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)Oc1ccc(C)cc1)[C@H]1CCC(C)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C22H26O3/c1-13-5-9-18(10-6-13)25-22(24)15(3)17-8-7-14(2)19-12-21(23)16(4)20(19)11-17/h5-6,9-10,14,17,19H,3,7-8,11-12H2,1-2,4H3/t14?,17-,19-/m0/s1 |
| InChIKey | DFUUXMAQGPDSOL-WGAGKFISSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|