C22H26O2 — CID 142319320
1-methoxy-4-[1-[4-(4-methylphenyl)cyclohexyl]ethenoxy]benzene (PubChem CID 142319320) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-methoxy-4-[1-[4-(4-methylphenyl)cyclohexyl]ethenoxy]benzene.
| Compound Name | 1-methoxy-4-[1-[4-(4-methylphenyl)cyclohexyl]ethenoxy]benzene |
|---|---|
| PubChem CID | 142319320 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-methoxy-4-[1-[4-(4-methylphenyl)cyclohexyl]ethenoxy]benzene |
| SMILES | C=C(Oc1ccc(OC)cc1)C1CCC(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C22H26O2/c1-16-4-6-19(7-5-16)20-10-8-18(9-11-20)17(2)24-22-14-12-21(23-3)13-15-22/h4-7,12-15,18,20H,2,8-11H2,1,3H3 |
| InChIKey | XDEPOLVVHIKSIL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|