C22H24O — CID 19984230
1-methoxy-4-[2-[4-(4-methylphenyl)cyclohexyl]ethynyl]benzene (PubChem CID 19984230) has the molecular formula C22H24O and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-methoxy-4-[2-[4-(4-methylphenyl)cyclohexyl]ethynyl]benzene.
| Compound Name | 1-methoxy-4-[2-[4-(4-methylphenyl)cyclohexyl]ethynyl]benzene |
|---|---|
| PubChem CID | 19984230 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-methoxy-4-[2-[4-(4-methylphenyl)cyclohexyl]ethynyl]benzene |
| SMILES | COc1ccc(C#CC2CCC(c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24O/c1-17-3-11-20(12-4-17)21-13-7-18(8-14-21)5-6-19-9-15-22(23-2)16-10-19/h3-4,9-12,15-16,18,21H,7-8,13-14H2,1-2H3 |
| InChIKey | LKSHXMDDIUBLTG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|