C22H23 — CID 59940176
CID 59940176 (PubChem CID 59940176) has the molecular formula C22H23 and a molecular weight of 287.43 g/mol.
| Compound Name | CID 59940176 |
|---|---|
| PubChem CID | 59940176 |
| Molecular Formula | C22H23 |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | — |
| SMILES | C[C]1CCC(c2ccc(C#Cc3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H23/c1-17-3-7-19(8-4-17)9-10-20-11-15-22(16-12-20)21-13-5-18(2)6-14-21/h3-4,7-8,11-12,15-16,21H,5-6,13-14H2,1-2H3 |
| InChIKey | UUJFBHQNSHZEHC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|