C22H32 — CID 59076908
CID 59076908 (PubChem CID 59076908) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol.
| Compound Name | CID 59076908 |
|---|---|
| PubChem CID | 59076908 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | — |
| SMILES | C[C]1CCC(CC[C]2CCC(c3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H32/c1-17-3-7-19(8-4-17)9-10-20-11-15-22(16-12-20)21-13-5-18(2)6-14-21/h5-6,13-14,19,22H,3-4,7-12,15-16H2,1-2H3 |
| InChIKey | PQNAREMAQFPXRL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |