C28H36 — CID 59055929
CID 59055929 (PubChem CID 59055929) has the molecular formula C28H36 and a molecular weight of 372.60 g/mol.
| Compound Name | CID 59055929 |
|---|---|
| PubChem CID | 59055929 |
| Molecular Formula | C28H36 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | — |
| SMILES | C[C]1CCC(c2ccc(-c3ccc(CC[C]4CCC(C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H36/c1-21-3-7-23(8-4-21)9-10-24-11-15-26(16-12-24)28-19-17-27(18-20-28)25-13-5-22(2)6-14-25/h11-12,15-21,25H,3-10,13-14H2,1-2H3 |
| InChIKey | IHMNSRJWQIVSAM-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |