C23H24 — CID 59929165
1-(4-ethenylcyclohexyl)-4-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 59929165) has the molecular formula C23H24 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-4-[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-4-[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 59929165 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-4-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | C=CC1CCC(c2ccc(C#Cc3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H24/c1-3-19-10-14-22(15-11-19)23-16-12-21(13-17-23)9-8-20-6-4-18(2)5-7-20/h3-7,12-13,16-17,19,22H,1,10-11,14-15H2,2H3 |
| InChIKey | IZDNMYNVRQMYKP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|