C23H42 — CID 161187621
1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-methylbenzene;methane;molecular hydrogen (PubChem CID 161187621) has the molecular formula C23H42 and a molecular weight of 318.59 g/mol. Its IUPAC name is 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-methylbenzene;methane;molecular hydrogen.
| Compound Name | 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-methylbenzene;methane;molecular hydrogen |
|---|---|
| PubChem CID | 161187621 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-methylbenzene;methane;molecular hydrogen |
| SMILES | C.C.C=CC1CCC(C2CCC(c3ccc(C)cc3)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C21H30.2CH4.2H2/c1-3-17-6-10-19(11-7-17)21-14-12-20(13-15-21)18-8-4-16(2)5-9-18;;;;/h3-5,8-9,17,19-21H,1,6-7,10-15H2,2H3;2*1H4;2*1H |
| InChIKey | UTHGWRMDWWRDSX-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|