C26H32N2O3 — CID 169409673
(5R,8S,8aS)-5-[3-(4-benzoylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one (PubChem CID 169409673) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is (5R,8S,8aS)-5-[3-(4-benzoylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one.
| Compound Name | (5R,8S,8aS)-5-[3-(4-benzoylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 169409673 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (5R,8S,8aS)-5-[3-(4-benzoylpiperazin-1-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
| SMILES | C=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)[C@@H]1CC[C@H](C)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C26H32N2O3/c1-17-9-10-21(15-23-19(3)24(29)16-22(17)23)18(2)25(30)27-11-13-28(14-12-27)26(31)20-7-5-4-6-8-20/h4-8,17,21-22H,2,9-16H2,1,3H3/t17-,21+,22-/m0/s1 |
| InChIKey | CMHLWUJZWZILHR-WTOYTKOKSA-N |
| XLogP | 3.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|