C15H22O2 — CID 15475316
(2S,4R,5S,8S,9R)-4,5,8,12-tetramethyl-3-oxatricyclo[7.3.0.02,4]dodec-1(12)-en-11-one (PubChem CID 15475316) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2S,4R,5S,8S,9R)-4,5,8,12-tetramethyl-3-oxatricyclo[7.3.0.02,4]dodec-1(12)-en-11-one.
| Compound Name | (2S,4R,5S,8S,9R)-4,5,8,12-tetramethyl-3-oxatricyclo[7.3.0.02,4]dodec-1(12)-en-11-one |
|---|---|
| PubChem CID | 15475316 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2S,4R,5S,8S,9R)-4,5,8,12-tetramethyl-3-oxatricyclo[7.3.0.02,4]dodec-1(12)-en-11-one |
| SMILES | CC1=C2[C@H](CC1=O)[C@@H](C)CC[C@H](C)[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C15H22O2/c1-8-5-6-9(2)15(4)14(17-15)13-10(3)12(16)7-11(8)13/h8-9,11,14H,5-7H2,1-4H3/t8-,9-,11+,14-,15+/m0/s1 |
| InChIKey | DAHTUHNTQCWSPH-NYWQGFLHSA-N |
| XLogP | 3.12 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|