About (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one
(1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one (PubChem CID 95240977) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one.
Analyze (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one?
The IUPAC name of (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one (CID 95240977) is (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one.
What is the SMILES notation for (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one?
The canonical SMILES for (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one is CC1(C)C(=O)[C@H]2CCO[C@@H]21.
What is the InChIKey of (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one?
The InChIKey is IBUYIUUEKIEMMA-VDTYLAMSSA-N. The full InChI is InChI=1S/C8H12O2/c1-8(2)6(9)5-3-4-10-7(5)8/h5,7H,3-4H2,1-2H3/t5-,7+/m1/s1.
What are the key properties of (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one?
(1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one has a molecular weight of 140.18 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one is sourced from PubChem (CID 95240977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).