C33H54O4 — CID 132501034
[(1R,2R,5S,7S,8S,10S,11S,14R,15R,18S,20R)-7-methoxy-1,2,5,15,19,19-hexamethyl-8-propan-2-yl-9-oxahexacyclo[12.8.0.02,11.05,10.08,10.015,20]docosan-18-yl] acetate (PubChem CID 132501034) has the molecular formula C33H54O4 and a molecular weight of 514.79 g/mol. Its IUPAC name is [(1R,2R,5S,7S,8S,10S,11S,14R,15R,18S,20R)-7-methoxy-1,2,5,15,19,19-hexamethyl-8-propan-2-yl-9-oxahexacyclo[12.8.0.02,11.05,10.08,10.015,20]docosan-18-yl] acetate.
| Compound Name | [(1R,2R,5S,7S,8S,10S,11S,14R,15R,18S,20R)-7-methoxy-1,2,5,15,19,19-hexamethyl-8-propan-2-yl-9-oxahexacyclo[12.8.0.02,11.05,10.08,10.015,20]docosan-18-yl] acetate |
|---|---|
| PubChem CID | 132501034 |
| Molecular Formula | C33H54O4 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | [(1R,2R,5S,7S,8S,10S,11S,14R,15R,18S,20R)-7-methoxy-1,2,5,15,19,19-hexamethyl-8-propan-2-yl-9-oxahexacyclo[12.8.0.02,11.05,10.08,10.015,20]docosan-18-yl] acetate |
| SMILES | CO[C@H]1C[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]5CC[C@]43C)[C@]23O[C@@]13C(C)C |
| InChI | InChI=1S/C33H54O4/c1-20(2)32-26(35-10)19-28(6)17-18-31(9)24(33(28,32)37-32)12-11-23-29(7)15-14-25(36-21(3)34)27(4,5)22(29)13-16-30(23,31)8/h20,22-26H,11-19H2,1-10H3/t22-,23+,24-,25-,26-,28-,29-,30+,31+,32-,33-/m0/s1 |
| InChIKey | WGOXHJRQOHZBRO-WCHIDLESSA-N |
| XLogP | 7.58 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|