C31H51ClO2 — CID 89026404
[(2S,4aR,10aR,10bR)-8-[(E)-2-chloroethenyl]-1,1,4a,7,10a,10b-hexamethyl-8-propyl-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-yl] acetate (PubChem CID 89026404) has the molecular formula C31H51ClO2 and a molecular weight of 491.20 g/mol. Its IUPAC name is [(2S,4aR,10aR,10bR)-8-[(E)-2-chloroethenyl]-1,1,4a,7,10a,10b-hexamethyl-8-propyl-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-yl] acetate.
| Compound Name | [(2S,4aR,10aR,10bR)-8-[(E)-2-chloroethenyl]-1,1,4a,7,10a,10b-hexamethyl-8-propyl-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-yl] acetate |
|---|---|
| PubChem CID | 89026404 |
| Molecular Formula | C31H51ClO2 |
| Molecular Weight | 491.20 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | [(2S,4aR,10aR,10bR)-8-[(E)-2-chloroethenyl]-1,1,4a,7,10a,10b-hexamethyl-8-propyl-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-yl] acetate |
| SMILES | CCCC1(/C=C/Cl)CC[C@]2(C)C(CCC3[C@@]4(C)CC[C@H](OC(C)=O)C(C)(C)C4CC[C@]32C)C1C |
| InChI | InChI=1S/C31H51ClO2/c1-9-14-31(19-20-32)18-17-29(7)23(21(31)2)10-11-25-28(6)15-13-26(34-22(3)33)27(4,5)24(28)12-16-30(25,29)8/h19-21,23-26H,9-18H2,1-8H3/b20-19+/t21?,23?,24?,25?,26-,28-,29+,30+,31?/m0/s1 |
| InChIKey | VGRIGROCOOWXJM-PKFRLMBMSA-N |
| XLogP | 9.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.20 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |