C32H52O2 — CID 3490789
(6,10,10,14,15,21,21-heptamethyl-9-hexacyclo[16.4.1.01,18.02,15.05,14.06,11]tricosanyl) acetate (PubChem CID 3490789) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is (6,10,10,14,15,21,21-heptamethyl-9-hexacyclo[16.4.1.01,18.02,15.05,14.06,11]tricosanyl) acetate.
| Compound Name | (6,10,10,14,15,21,21-heptamethyl-9-hexacyclo[16.4.1.01,18.02,15.05,14.06,11]tricosanyl) acetate |
|---|---|
| PubChem CID | 3490789 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (6,10,10,14,15,21,21-heptamethyl-9-hexacyclo[16.4.1.01,18.02,15.05,14.06,11]tricosanyl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C3(C)CCC34CCC(C)(C)CC23C4)C1(C)C |
| InChI | InChI=1S/C32H52O2/c1-21(33)34-25-12-13-28(6)22(27(25,4)5)11-14-29(7)23(28)9-10-24-30(29,8)16-18-31-17-15-26(2,3)19-32(24,31)20-31/h22-25H,9-20H2,1-8H3 |
| InChIKey | UENYMQKYYROTRY-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |