C12H22O2 — CID 123414870
[(3R)-3-methyl-3-propan-2-ylcyclohexyl] acetate (PubChem CID 123414870) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is [(3R)-3-methyl-3-propan-2-ylcyclohexyl] acetate.
| Compound Name | [(3R)-3-methyl-3-propan-2-ylcyclohexyl] acetate |
|---|---|
| PubChem CID | 123414870 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [(3R)-3-methyl-3-propan-2-ylcyclohexyl] acetate |
| SMILES | CC(=O)OC1CCC[C@@](C)(C(C)C)C1 |
| InChI | InChI=1S/C12H22O2/c1-9(2)12(4)7-5-6-11(8-12)14-10(3)13/h9,11H,5-8H2,1-4H3/t11?,12-/m1/s1 |
| InChIKey | WMGFBUJIRDCHAA-PIJUOVFKSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |