C12H22O2 — CID 57151132
2-(3-methyl-3-propan-2-ylcyclohexyl)oxyacetaldehyde (PubChem CID 57151132) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyacetaldehyde.
| Compound Name | 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyacetaldehyde |
|---|---|
| PubChem CID | 57151132 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyacetaldehyde |
| SMILES | CC(C)C1(C)CCCC(OCC=O)C1 |
| InChI | InChI=1S/C12H22O2/c1-10(2)12(3)6-4-5-11(9-12)14-8-7-13/h7,10-11H,4-6,8-9H2,1-3H3 |
| InChIKey | QNNNHSQWCVJQKK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|