C26H44O5S — CID 70492567
2-[2-[(3aR,4R,5R,6aR)-5-hydroxy-4-[3-hydroxy-4-[(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl]oxybut-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid (PubChem CID 70492567) has the molecular formula C26H44O5S and a molecular weight of 468.70 g/mol. Its IUPAC name is 2-[2-[(3aR,4R,5R,6aR)-5-hydroxy-4-[3-hydroxy-4-[(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl]oxybut-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3aR,4R,5R,6aR)-5-hydroxy-4-[3-hydroxy-4-[(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl]oxybut-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 70492567 |
| Molecular Formula | C26H44O5S |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 2-[2-[(3aR,4R,5R,6aR)-5-hydroxy-4-[3-hydroxy-4-[(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl]oxybut-1-enyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid |
| SMILES | CC(C)[C@@]1(C)CCC[C@H](OCC(O)C=C[C@@H]2[C@@H]3CC(CCSCC(=O)O)C[C@@H]3C[C@H]2O)C1 |
| InChI | InChI=1S/C26H44O5S/c1-17(2)26(3)9-4-5-21(14-26)31-15-20(27)6-7-22-23-12-18(8-10-32-16-25(29)30)11-19(23)13-24(22)28/h6-7,17-24,27-28H,4-5,8-16H2,1-3H3,(H,29,30)/t18?,19-,20?,21+,22-,23-,24-,26+/m1/s1 |
| InChIKey | ZXXWJJYVYJIOET-XCQGRIBHSA-N |
| XLogP | 4.76 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|