C16H25NO3S — CID 54100350
[(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl] 3-[(2R)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate (PubChem CID 54100350) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is [(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl] 3-[(2R)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate.
| Compound Name | [(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl] 3-[(2R)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 54100350 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [(1S,3S)-3-methyl-3-propan-2-ylcyclohexyl] 3-[(2R)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate |
| SMILES | CC(C)[C@@]1(C)CCC[C@H](OC(=O)C=CS[C@@H]2CC(=O)N2)C1 |
| InChI | InChI=1S/C16H25NO3S/c1-11(2)16(3)7-4-5-12(10-16)20-15(19)6-8-21-14-9-13(18)17-14/h6,8,11-12,14H,4-5,7,9-10H2,1-3H3,(H,17,18)/t12-,14+,16-/m0/s1 |
| InChIKey | NACMAVBRJKYMGU-BJJXKVORSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|