C23H38O7S — CID 58859371
methyl (1R,4S,5R,9S,10S,12R,13R,14S)-14-(methoxymethoxy)-5,9-dimethyl-13-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 58859371) has the molecular formula C23H38O7S and a molecular weight of 458.62 g/mol. Its IUPAC name is methyl (1R,4S,5R,9S,10S,12R,13R,14S)-14-(methoxymethoxy)-5,9-dimethyl-13-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1R,4S,5R,9S,10S,12R,13R,14S)-14-(methoxymethoxy)-5,9-dimethyl-13-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 58859371 |
| Molecular Formula | C23H38O7S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | methyl (1R,4S,5R,9S,10S,12R,13R,14S)-14-(methoxymethoxy)-5,9-dimethyl-13-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COCO[C@@H]1[C@H](OS(C)(=O)=O)[C@@H]2CC[C@@]13CC[C@H]1[C@@](C)(CCC[C@@]1(C)C(=O)OC)[C@@H]3C2 |
| InChI | InChI=1S/C23H38O7S/c1-21-9-6-10-22(2,20(24)28-4)16(21)8-12-23-11-7-15(13-17(21)23)18(30-31(5,25)26)19(23)29-14-27-3/h15-19H,6-14H2,1-5H3/t15-,16+,17+,18-,19-,21-,22-,23+/m1/s1 |
| InChIKey | QONIORJROGGSMB-CEBLYAIPSA-N |
| XLogP | 3.52 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|