C23H38O4S — CID 58859337
methyl (1S,4S,5R,9S,10S,12R,13S,14R)-14-methoxy-5,9-dimethyl-13-(methylsulfinylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 58859337) has the molecular formula C23H38O4S and a molecular weight of 410.62 g/mol. Its IUPAC name is methyl (1S,4S,5R,9S,10S,12R,13S,14R)-14-methoxy-5,9-dimethyl-13-(methylsulfinylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1S,4S,5R,9S,10S,12R,13S,14R)-14-methoxy-5,9-dimethyl-13-(methylsulfinylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 58859337 |
| Molecular Formula | C23H38O4S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl (1S,4S,5R,9S,10S,12R,13S,14R)-14-methoxy-5,9-dimethyl-13-(methylsulfinylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3C[C@H]4CC[C@@]3(CC[C@@H]21)[C@H](OC)[C@H]4CS(C)=O |
| InChI | InChI=1S/C23H38O4S/c1-21-9-6-10-22(2,20(24)27-4)17(21)8-12-23-11-7-15(13-18(21)23)16(14-28(5)25)19(23)26-3/h15-19H,6-14H2,1-5H3/t15-,16+,17+,18+,19-,21-,22-,23+,28?/m1/s1 |
| InChIKey | RDOVMBYWQMERLZ-WZRXOPCXSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |