C22H36O5S2 — CID 58859324
(1S,4S,5R,9S,10S,12R,13S,14S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 58859324) has the molecular formula C22H36O5S2 and a molecular weight of 444.66 g/mol. Its IUPAC name is (1S,4S,5R,9S,10S,12R,13S,14S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1S,4S,5R,9S,10S,12R,13S,14S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 58859324 |
| Molecular Formula | C22H36O5S2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (1S,4S,5R,9S,10S,12R,13S,14S)-5,9-dimethyl-13-(methylsulfanylmethyl)-14-methylsulfonyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | CSC[C@H]1[C@@H]2CC[C@@]3(CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)O)[C@@H]3C2)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C22H36O5S2/c1-20-8-5-9-21(2,19(23)24)16(20)7-11-22-10-6-14(12-17(20)22)15(13-28-3)18(22)27-29(4,25)26/h14-18H,5-13H2,1-4H3,(H,23,24)/t14-,15+,16+,17+,18+,20-,21-,22+/m1/s1 |
| InChIKey | VWFDBJZRIRGRLT-ODCIOILUSA-N |
| XLogP | 4.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|