C22H36O2S — CID 71190213
1-[(1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-5,9-dimethyl-13-(methylsulfanylmethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethanone (PubChem CID 71190213) has the molecular formula C22H36O2S and a molecular weight of 364.60 g/mol. Its IUPAC name is 1-[(1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-5,9-dimethyl-13-(methylsulfanylmethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethanone.
| Compound Name | 1-[(1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-5,9-dimethyl-13-(methylsulfanylmethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethanone |
|---|---|
| PubChem CID | 71190213 |
| Molecular Formula | C22H36O2S |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-[(1S,4S,5R,9S,10S,12S,13S,14R)-14-hydroxy-5,9-dimethyl-13-(methylsulfanylmethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]ethanone |
| SMILES | CSC[C@H]1[C@H]2CC[C@@]3(CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(C)=O)[C@@H]3C2)[C@@H]1O |
| InChI | InChI=1S/C22H36O2S/c1-14(23)20(2)8-5-9-21(3)17(20)7-11-22-10-6-15(12-18(21)22)16(13-25-4)19(22)24/h15-19,24H,5-13H2,1-4H3/t15-,16-,17+,18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | FLEABZCSMPZFFE-ROXBXATMSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |