C28H40O6S — CID 89354603
methyl (1S,4S,5R,9S,10S,12S,13R,14R)-14-hydroxy-5,9-dimethyl-13-[(4-methylphenyl)sulfonyloxymethyl]tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 89354603) has the molecular formula C28H40O6S and a molecular weight of 504.69 g/mol. Its IUPAC name is methyl (1S,4S,5R,9S,10S,12S,13R,14R)-14-hydroxy-5,9-dimethyl-13-[(4-methylphenyl)sulfonyloxymethyl]tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1S,4S,5R,9S,10S,12S,13R,14R)-14-hydroxy-5,9-dimethyl-13-[(4-methylphenyl)sulfonyloxymethyl]tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 89354603 |
| Molecular Formula | C28H40O6S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | methyl (1S,4S,5R,9S,10S,12S,13R,14R)-14-hydroxy-5,9-dimethyl-13-[(4-methylphenyl)sulfonyloxymethyl]tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3C[C@@H]4CC[C@@]3(CC[C@@H]21)[C@H](O)[C@H]4COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H40O6S/c1-18-6-8-20(9-7-18)35(31,32)34-17-21-19-10-14-28(24(21)29)15-11-22-26(2,23(28)16-19)12-5-13-27(22,3)25(30)33-4/h6-9,19,21-24,29H,5,10-17H2,1-4H3/t19-,21-,22-,23-,24+,26+,27+,28-/m0/s1 |
| InChIKey | CPABPMQOLRXYDP-RPAOXOHCSA-N |
| XLogP | 4.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|