C19H26O8S — CID 10982568
methyl (1R,2S,3S,5R,6R)-3-hydroxy-2-methoxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6-(2-oxoethyl)cyclohexane-1-carboxylate (PubChem CID 10982568) has the molecular formula C19H26O8S and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl (1R,2S,3S,5R,6R)-3-hydroxy-2-methoxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6-(2-oxoethyl)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S,5R,6R)-3-hydroxy-2-methoxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6-(2-oxoethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10982568 |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl (1R,2S,3S,5R,6R)-3-hydroxy-2-methoxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6-(2-oxoethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](OC)[C@@H](O)CC(COS(=O)(=O)c2ccc(C)cc2)[C@H]1CC=O |
| InChI | InChI=1S/C19H26O8S/c1-12-4-6-14(7-5-12)28(23,24)27-11-13-10-16(21)18(25-2)17(19(22)26-3)15(13)8-9-20/h4-7,9,13,15-18,21H,8,10-11H2,1-3H3/t13?,15-,16+,17-,18-/m1/s1 |
| InChIKey | NVOLVBXJBMDNBO-MOUFXGFKSA-N |
| XLogP | 1.09 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|