C16H22O5S — CID 10853582
[(1S,2S,4R,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate (PubChem CID 10853582) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is [(1S,2S,4R,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,4R,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10853582 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(1S,2S,4R,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.2]octanyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C[C@H]3CC[C@@H]2[C@H](O)[C@@H]3O)cc1 |
| InChI | InChI=1S/C16H22O5S/c1-10-2-5-13(6-3-10)22(19,20)21-9-12-8-11-4-7-14(12)16(18)15(11)17/h2-3,5-6,11-12,14-18H,4,7-9H2,1H3/t11-,12-,14+,15-,16+/m1/s1 |
| InChIKey | RKZFEFPHCQVVSR-DEDQRHPVSA-N |
| XLogP | 1.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|