C21H32O4 — CID 15736784
methyl (1R,2S,4S,5R,9S,10S,13S)-2,13-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate (PubChem CID 15736784) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (1R,2S,4S,5R,9S,10S,13S)-2,13-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate.
| Compound Name | methyl (1R,2S,4S,5R,9S,10S,13S)-2,13-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate |
|---|---|
| PubChem CID | 15736784 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (1R,2S,4S,5R,9S,10S,13S)-2,13-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@]4(O)C[C@]3(C=C4C)[C@@H](O)C[C@@H]21 |
| InChI | InChI=1S/C21H32O4/c1-13-11-20-12-21(13,24)9-6-14(20)18(2)7-5-8-19(3,17(23)25-4)15(18)10-16(20)22/h11,14-16,22,24H,5-10,12H2,1-4H3/t14-,15-,16-,18-,19+,20-,21-/m0/s1 |
| InChIKey | CRUOJKPVPPGELC-CWQYXLLMSA-N |
| XLogP | 3.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|