C27H32O4 — CID 57327452
methyl (1R,14R,15R,19S,20R)-1,15,19-trimethyl-5,8-dioxopentacyclo[12.8.0.02,11.04,9.015,20]docosa-2,4(9),6,10-tetraene-19-carboxylate (PubChem CID 57327452) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl (1R,14R,15R,19S,20R)-1,15,19-trimethyl-5,8-dioxopentacyclo[12.8.0.02,11.04,9.015,20]docosa-2,4(9),6,10-tetraene-19-carboxylate.
| Compound Name | methyl (1R,14R,15R,19S,20R)-1,15,19-trimethyl-5,8-dioxopentacyclo[12.8.0.02,11.04,9.015,20]docosa-2,4(9),6,10-tetraene-19-carboxylate |
|---|---|
| PubChem CID | 57327452 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl (1R,14R,15R,19S,20R)-1,15,19-trimethyl-5,8-dioxopentacyclo[12.8.0.02,11.04,9.015,20]docosa-2,4(9),6,10-tetraene-19-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)[C@H]3CCc4cc5c(cc4[C@]3(C)CC[C@H]21)C(=O)C=CC5=O |
| InChI | InChI=1S/C27H32O4/c1-25-13-10-23-26(2,11-5-12-27(23,3)24(30)31-4)22(25)9-6-16-14-17-18(15-19(16)25)21(29)8-7-20(17)28/h7-8,14-15,22-23H,5-6,9-13H2,1-4H3/t22-,23+,25-,26+,27-/m0/s1 |
| InChIKey | IHLFXCPIQQQTME-FOABZHLWSA-N |
| XLogP | 5.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|