C21H32O4 — CID 58859407
methyl (1S,4S,5R,9S,10S,12R,13R)-13-(hydroxymethyl)-5,9-dimethyl-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 58859407) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (1S,4S,5R,9S,10S,12R,13R)-13-(hydroxymethyl)-5,9-dimethyl-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1S,4S,5R,9S,10S,12R,13R)-13-(hydroxymethyl)-5,9-dimethyl-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 58859407 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (1S,4S,5R,9S,10S,12R,13R)-13-(hydroxymethyl)-5,9-dimethyl-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3C[C@H]4CC[C@@]3(CC[C@@H]21)C(=O)[C@H]4CO |
| InChI | InChI=1S/C21H32O4/c1-19-7-4-8-20(2,18(24)25-3)15(19)6-10-21-9-5-13(11-16(19)21)14(12-22)17(21)23/h13-16,22H,4-12H2,1-3H3/t13-,14+,15+,16+,19-,20-,21+/m1/s1 |
| InChIKey | QKIMCMGMFFYHBN-QZVDPCOZSA-N |
| XLogP | 3.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |