C30H42N2O2 — CID 71739933
ethyl (1S,4S,5R,9S,10S,13S,18R)-5,9,13-trimethyl-16-(4-methylphenyl)-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate (PubChem CID 71739933) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,18R)-5,9,13-trimethyl-16-(4-methylphenyl)-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,18R)-5,9,13-trimethyl-16-(4-methylphenyl)-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate |
|---|---|
| PubChem CID | 71739933 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,18R)-5,9,13-trimethyl-16-(4-methylphenyl)-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@@H]1CN(c2ccc(C)cc2)N=C14 |
| InChI | InChI=1S/C30H42N2O2/c1-6-34-26(33)29(5)15-7-14-28(4)23(29)13-17-30-19-27(3,16-12-24(28)30)25-22(30)18-32(31-25)21-10-8-20(2)9-11-21/h8-11,22-24H,6-7,12-19H2,1-5H3/t22-,23+,24+,27+,28-,29-,30-/m1/s1 |
| InChIKey | FOCGRMFAHAFHIB-OMIXQGPCSA-N |
| XLogP | 6.76 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |