C28H37NO2 — CID 44590396
ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-15-azahexacyclo[11.9.1.01,10.04,9.014,22.016,21]tricosa-14(22),16,18,20-tetraene-5-carboxylate (PubChem CID 44590396) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-15-azahexacyclo[11.9.1.01,10.04,9.014,22.016,21]tricosa-14(22),16,18,20-tetraene-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-15-azahexacyclo[11.9.1.01,10.04,9.014,22.016,21]tricosa-14(22),16,18,20-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 44590396 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-15-azahexacyclo[11.9.1.01,10.04,9.014,22.016,21]tricosa-14(22),16,18,20-tetraene-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)c1c4[nH]c2ccccc12 |
| InChI | InChI=1S/C28H37NO2/c1-5-31-24(30)27(4)14-8-13-26(3)20(27)12-16-28-17-25(2,15-11-21(26)28)23-22(28)18-9-6-7-10-19(18)29-23/h6-7,9-10,20-21,29H,5,8,11-17H2,1-4H3/t20-,21-,25-,26+,27+,28-/m0/s1 |
| InChIKey | OSLWLBNQGBGFOG-QOZQIPARSA-N |
| XLogP | 6.65 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |